C17H24N2O5 — CID 134541445
2-[methyl-[2-[(2-methyl-4-oxo-4-phenylmethoxybutan-2-yl)amino]acetyl]amino]acetic acid (PubChem CID 134541445) has the molecular formula C17H24N2O5 and a molecular weight of 336.39 g/mol. Its IUPAC name is 2-[methyl-[2-[(2-methyl-4-oxo-4-phenylmethoxybutan-2-yl)amino]acetyl]amino]acetic acid.
| Compound Name | 2-[methyl-[2-[(2-methyl-4-oxo-4-phenylmethoxybutan-2-yl)amino]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 134541445 |
| Molecular Formula | C17H24N2O5 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 2-[methyl-[2-[(2-methyl-4-oxo-4-phenylmethoxybutan-2-yl)amino]acetyl]amino]acetic acid |
| SMILES | CN(CC(=O)O)C(=O)CNC(C)(C)CC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H24N2O5/c1-17(2,18-10-14(20)19(3)11-15(21)22)9-16(23)24-12-13-7-5-4-6-8-13/h4-8,18H,9-12H2,1-3H3,(H,21,22) |
| InChIKey | XFELICFQKONODV-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |