C21H30FN3O6S — CID 134541528
N-[(2S)-2-[3-(cyclopropylmethoxy)-4-fluorophenyl]-2-hydroxybutyl]-4-(2,4-dioxoimidazolidin-1-yl)butane-1-sulfonamide (PubChem CID 134541528) has the molecular formula C21H30FN3O6S and a molecular weight of 471.55 g/mol. Its IUPAC name is N-[(2S)-2-[3-(cyclopropylmethoxy)-4-fluorophenyl]-2-hydroxybutyl]-4-(2,4-dioxoimidazolidin-1-yl)butane-1-sulfonamide.
| Compound Name | N-[(2S)-2-[3-(cyclopropylmethoxy)-4-fluorophenyl]-2-hydroxybutyl]-4-(2,4-dioxoimidazolidin-1-yl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 134541528 |
| Molecular Formula | C21H30FN3O6S |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | N-[(2S)-2-[3-(cyclopropylmethoxy)-4-fluorophenyl]-2-hydroxybutyl]-4-(2,4-dioxoimidazolidin-1-yl)butane-1-sulfonamide |
| SMILES | CC[C@@](O)(CNS(=O)(=O)CCCCN1CC(=O)NC1=O)c1ccc(F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C21H30FN3O6S/c1-2-21(28,16-7-8-17(22)18(11-16)31-13-15-5-6-15)14-23-32(29,30)10-4-3-9-25-12-19(26)24-20(25)27/h7-8,11,15,23,28H,2-6,9-10,12-14H2,1H3,(H,24,26,27)/t21-/m1/s1 |
| InChIKey | LIKQWQSQLVXIOF-OAQYLSRUSA-N |
| XLogP | 1.46 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|