C22H29N7O5S2 — CID 134541923
N-[4-(2,6-dimethoxyphenyl)-5-(4-methyl-1,3-thiazol-2-yl)-1,2,4-triazol-3-yl]-2-[(6S)-3,6-dimethyl-2-oxo-1,3-diazinan-1-yl]ethanesulfonamide (PubChem CID 134541923) has the molecular formula C22H29N7O5S2 and a molecular weight of 535.65 g/mol. Its IUPAC name is N-[4-(2,6-dimethoxyphenyl)-5-(4-methyl-1,3-thiazol-2-yl)-1,2,4-triazol-3-yl]-2-[(6S)-3,6-dimethyl-2-oxo-1,3-diazinan-1-yl]ethanesulfonamide.
| Compound Name | N-[4-(2,6-dimethoxyphenyl)-5-(4-methyl-1,3-thiazol-2-yl)-1,2,4-triazol-3-yl]-2-[(6S)-3,6-dimethyl-2-oxo-1,3-diazinan-1-yl]ethanesulfonamide |
|---|---|
| PubChem CID | 134541923 |
| Molecular Formula | C22H29N7O5S2 |
| Molecular Weight | 535.65 g/mol |
| Exact Mass | 535.17 |
| IUPAC Name | N-[4-(2,6-dimethoxyphenyl)-5-(4-methyl-1,3-thiazol-2-yl)-1,2,4-triazol-3-yl]-2-[(6S)-3,6-dimethyl-2-oxo-1,3-diazinan-1-yl]ethanesulfonamide |
| SMILES | COc1cccc(OC)c1-n1c(NS(=O)(=O)CCN2C(=O)N(C)CC[C@@H]2C)nnc1-c1nc(C)cs1 |
| InChI | InChI=1S/C22H29N7O5S2/c1-14-13-35-20(23-14)19-24-25-21(29(19)18-16(33-4)7-6-8-17(18)34-5)26-36(31,32)12-11-28-15(2)9-10-27(3)22(28)30/h6-8,13,15H,9-12H2,1-5H3,(H,25,26)/t15-/m0/s1 |
| InChIKey | IBWGKSSKZABQTB-HNNXBMFYSA-N |
| XLogP | 2.60 |
| TPSA | 131.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.65 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |