About propyl 2-bromo-3,4,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylate
propyl 2-bromo-3,4,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylate (PubChem CID 134542047) has the molecular formula C15H13BrO6
and a molecular weight of 369.17 g/mol. Its IUPAC name is propyl 2-bromo-3,4,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylate.
Molecular Properties
| Compound Name | propyl 2-bromo-3,4,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylate |
| PubChem CID | 134542047 |
| Molecular Formula | C15H13BrO6 |
| Molecular Weight | 369.17 g/mol |
| Exact Mass | 367.99 |
| IUPAC Name | propyl 2-bromo-3,4,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylate |
| SMILES | CCCOC(=O)c1cc(=O)c(O)c2c(O)c(O)c(Br)cc2c1 |
| InChI | InChI=1S/C15H13BrO6/c1-2-3-22-15(21)8-4-7-5-9(16)12(18)14(20)11(7)13(19)10(17)6-8/h4-6,18,20H,2-3H2,1H3,(H,17,19) |
| InChIKey | XZYHLKMGTKLENS-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.17 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze propyl 2-bromo-3,4,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 2-bromo-3,4,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylate?
The IUPAC name of propyl 2-bromo-3,4,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylate (CID 134542047) is propyl 2-bromo-3,4,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylate.
What is the SMILES notation for propyl 2-bromo-3,4,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylate?
The canonical SMILES for propyl 2-bromo-3,4,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylate is CCCOC(=O)c1cc(=O)c(O)c2c(O)c(O)c(Br)cc2c1.
What is the InChIKey of propyl 2-bromo-3,4,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylate?
The InChIKey is XZYHLKMGTKLENS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13BrO6/c1-2-3-22-15(21)8-4-7-5-9(16)12(18)14(20)11(7)13(19)10(17)6-8/h4-6,18,20H,2-3H2,1H3,(H,17,19).
What are the key properties of propyl 2-bromo-3,4,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylate?
propyl 2-bromo-3,4,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylate has a molecular weight of 369.17 g/mol, XLogP of 2.65, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 2-bromo-3,4,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylate is sourced from PubChem (CID 134542047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).