C24H26FN7O5S2 — CID 134542082
(1R,2S)-N-[4-(2,6-dimethoxyphenyl)-5-(4-methyl-1,3-thiazol-2-yl)-1,2,4-triazol-3-yl]-1-(5-fluoropyrimidin-2-yl)-1-prop-2-enoxypropane-2-sulfonamide (PubChem CID 134542082) has the molecular formula C24H26FN7O5S2 and a molecular weight of 575.65 g/mol. Its IUPAC name is (1R,2S)-N-[4-(2,6-dimethoxyphenyl)-5-(4-methyl-1,3-thiazol-2-yl)-1,2,4-triazol-3-yl]-1-(5-fluoropyrimidin-2-yl)-1-prop-2-enoxypropane-2-sulfonamide.
| Compound Name | (1R,2S)-N-[4-(2,6-dimethoxyphenyl)-5-(4-methyl-1,3-thiazol-2-yl)-1,2,4-triazol-3-yl]-1-(5-fluoropyrimidin-2-yl)-1-prop-2-enoxypropane-2-sulfonamide |
|---|---|
| PubChem CID | 134542082 |
| Molecular Formula | C24H26FN7O5S2 |
| Molecular Weight | 575.65 g/mol |
| Exact Mass | 575.14 |
| IUPAC Name | (1R,2S)-N-[4-(2,6-dimethoxyphenyl)-5-(4-methyl-1,3-thiazol-2-yl)-1,2,4-triazol-3-yl]-1-(5-fluoropyrimidin-2-yl)-1-prop-2-enoxypropane-2-sulfonamide |
| SMILES | C=CCO[C@H](c1ncc(F)cn1)[C@H](C)S(=O)(=O)Nc1nnc(-c2nc(C)cs2)n1-c1c(OC)cccc1OC |
| InChI | InChI=1S/C24H26FN7O5S2/c1-6-10-37-20(21-26-11-16(25)12-27-21)15(3)39(33,34)31-24-30-29-22(23-28-14(2)13-38-23)32(24)19-17(35-4)8-7-9-18(19)36-5/h6-9,11-13,15,20H,1,10H2,2-5H3,(H,30,31)/t15-,20-/m0/s1 |
| InChIKey | MQYJJWAGCNNZAJ-YWZLYKJASA-N |
| XLogP | 3.72 |
| TPSA | 143.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.65 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|