C19H20Cl2N7O+ — CID 134542331
3-amino-7-chloro-N-[(5-chloro-1,3-diethylbenzimidazol-1-ium-2-yl)methyl]-5H-pyrrolo[2,3-b]pyrazine-2-carboxamide (PubChem CID 134542331) has the molecular formula C19H20Cl2N7O+ and a molecular weight of 433.32 g/mol. Its IUPAC name is 3-amino-7-chloro-N-[(5-chloro-1,3-diethylbenzimidazol-1-ium-2-yl)methyl]-5H-pyrrolo[2,3-b]pyrazine-2-carboxamide.
| Compound Name | 3-amino-7-chloro-N-[(5-chloro-1,3-diethylbenzimidazol-1-ium-2-yl)methyl]-5H-pyrrolo[2,3-b]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 134542331 |
| Molecular Formula | C19H20Cl2N7O+ |
| Molecular Weight | 433.32 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | 3-amino-7-chloro-N-[(5-chloro-1,3-diethylbenzimidazol-1-ium-2-yl)methyl]-5H-pyrrolo[2,3-b]pyrazine-2-carboxamide |
| SMILES | CCn1c(CNC(=O)c2nc3c(Cl)c[nH]c3nc2N)[n+](CC)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C19H19Cl2N7O/c1-3-27-12-6-5-10(20)7-13(12)28(4-2)14(27)9-24-19(29)16-17(22)26-18-15(25-16)11(21)8-23-18/h5-8H,3-4,9H2,1-2H3,(H3-,22,23,24,25,26,29)/p+1 |
| InChIKey | URVCBRGBGUUPJB-UHFFFAOYSA-O |
| XLogP | 3.06 |
| TPSA | 105.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.32 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|