About N-[[(4R)-3,3-difluoropiperidin-4-yl]methyl]-5-(trifluoromethyl)pyrimidin-2-amine
N-[[(4R)-3,3-difluoropiperidin-4-yl]methyl]-5-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 134542360) has the molecular formula C11H13F5N4
and a molecular weight of 296.24 g/mol. Its IUPAC name is N-[[(4R)-3,3-difluoropiperidin-4-yl]methyl]-5-(trifluoromethyl)pyrimidin-2-amine.
Molecular Properties
| Compound Name | N-[[(4R)-3,3-difluoropiperidin-4-yl]methyl]-5-(trifluoromethyl)pyrimidin-2-amine |
| PubChem CID | 134542360 |
| Molecular Formula | C11H13F5N4 |
| Molecular Weight | 296.24 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | N-[[(4R)-3,3-difluoropiperidin-4-yl]methyl]-5-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | FC(F)(F)c1cnc(NC[C@H]2CCNCC2(F)F)nc1 |
| InChI | InChI=1S/C11H13F5N4/c12-10(13)6-17-2-1-7(10)3-18-9-19-4-8(5-20-9)11(14,15)16/h4-5,7,17H,1-3,6H2,(H,18,19,20)/t7-/m1/s1 |
| InChIKey | MIGQCUIVSRERGE-SSDOTTSWSA-N |
| XLogP | 2.15 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.24 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[(4R)-3,3-difluoropiperidin-4-yl]methyl]-5-(trifluoromethyl)pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(4R)-3,3-difluoropiperidin-4-yl]methyl]-5-(trifluoromethyl)pyrimidin-2-amine?
The IUPAC name of N-[[(4R)-3,3-difluoropiperidin-4-yl]methyl]-5-(trifluoromethyl)pyrimidin-2-amine (CID 134542360) is N-[[(4R)-3,3-difluoropiperidin-4-yl]methyl]-5-(trifluoromethyl)pyrimidin-2-amine.
What is the SMILES notation for N-[[(4R)-3,3-difluoropiperidin-4-yl]methyl]-5-(trifluoromethyl)pyrimidin-2-amine?
The canonical SMILES for N-[[(4R)-3,3-difluoropiperidin-4-yl]methyl]-5-(trifluoromethyl)pyrimidin-2-amine is FC(F)(F)c1cnc(NC[C@H]2CCNCC2(F)F)nc1.
What is the InChIKey of N-[[(4R)-3,3-difluoropiperidin-4-yl]methyl]-5-(trifluoromethyl)pyrimidin-2-amine?
The InChIKey is MIGQCUIVSRERGE-SSDOTTSWSA-N. The full InChI is InChI=1S/C11H13F5N4/c12-10(13)6-17-2-1-7(10)3-18-9-19-4-8(5-20-9)11(14,15)16/h4-5,7,17H,1-3,6H2,(H,18,19,20)/t7-/m1/s1.
What are the key properties of N-[[(4R)-3,3-difluoropiperidin-4-yl]methyl]-5-(trifluoromethyl)pyrimidin-2-amine?
N-[[(4R)-3,3-difluoropiperidin-4-yl]methyl]-5-(trifluoromethyl)pyrimidin-2-amine has a molecular weight of 296.24 g/mol, XLogP of 2.15, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(4R)-3,3-difluoropiperidin-4-yl]methyl]-5-(trifluoromethyl)pyrimidin-2-amine is sourced from PubChem (CID 134542360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).