C17H18N4O5S2 — CID 134542365
N-[4-(2,6-dimethoxyphenyl)-5-thiophen-2-yl-1,2,4-triazol-3-yl]-3-oxopropane-1-sulfonamide (PubChem CID 134542365) has the molecular formula C17H18N4O5S2 and a molecular weight of 422.49 g/mol. Its IUPAC name is N-[4-(2,6-dimethoxyphenyl)-5-thiophen-2-yl-1,2,4-triazol-3-yl]-3-oxopropane-1-sulfonamide.
| Compound Name | N-[4-(2,6-dimethoxyphenyl)-5-thiophen-2-yl-1,2,4-triazol-3-yl]-3-oxopropane-1-sulfonamide |
|---|---|
| PubChem CID | 134542365 |
| Molecular Formula | C17H18N4O5S2 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | N-[4-(2,6-dimethoxyphenyl)-5-thiophen-2-yl-1,2,4-triazol-3-yl]-3-oxopropane-1-sulfonamide |
| SMILES | COc1cccc(OC)c1-n1c(NS(=O)(=O)CCC=O)nnc1-c1cccs1 |
| InChI | InChI=1S/C17H18N4O5S2/c1-25-12-6-3-7-13(26-2)15(12)21-16(14-8-4-10-27-14)18-19-17(21)20-28(23,24)11-5-9-22/h3-4,6-10H,5,11H2,1-2H3,(H,19,20) |
| InChIKey | INELSPUNEPNPPI-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 112.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|