C12H13N3O3S — CID 134542367
1-(2,4-dicyanophenyl)-1-methoxypropane-2-sulfonamide (PubChem CID 134542367) has the molecular formula C12H13N3O3S and a molecular weight of 279.32 g/mol. Its IUPAC name is 1-(2,4-dicyanophenyl)-1-methoxypropane-2-sulfonamide.
| Compound Name | 1-(2,4-dicyanophenyl)-1-methoxypropane-2-sulfonamide |
|---|---|
| PubChem CID | 134542367 |
| Molecular Formula | C12H13N3O3S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 1-(2,4-dicyanophenyl)-1-methoxypropane-2-sulfonamide |
| SMILES | COC(c1ccc(C#N)cc1C#N)C(C)S(N)(=O)=O |
| InChI | InChI=1S/C12H13N3O3S/c1-8(19(15,16)17)12(18-2)11-4-3-9(6-13)5-10(11)7-14/h3-5,8,12H,1-2H3,(H2,15,16,17) |
| InChIKey | TUSGJTDHQYLCHY-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 116.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |