C23H27N7O5S2 — CID 134542406
(1R,2S)-N-[4-(2,6-dimethoxyphenyl)-5-(5-methyl-1,3-thiazol-2-yl)-1,2,4-triazol-3-yl]-1-methoxy-1-(5-methylpyrimidin-2-yl)propane-2-sulfonamide (PubChem CID 134542406) has the molecular formula C23H27N7O5S2 and a molecular weight of 545.65 g/mol. Its IUPAC name is (1R,2S)-N-[4-(2,6-dimethoxyphenyl)-5-(5-methyl-1,3-thiazol-2-yl)-1,2,4-triazol-3-yl]-1-methoxy-1-(5-methylpyrimidin-2-yl)propane-2-sulfonamide.
| Compound Name | (1R,2S)-N-[4-(2,6-dimethoxyphenyl)-5-(5-methyl-1,3-thiazol-2-yl)-1,2,4-triazol-3-yl]-1-methoxy-1-(5-methylpyrimidin-2-yl)propane-2-sulfonamide |
|---|---|
| PubChem CID | 134542406 |
| Molecular Formula | C23H27N7O5S2 |
| Molecular Weight | 545.65 g/mol |
| Exact Mass | 545.15 |
| IUPAC Name | (1R,2S)-N-[4-(2,6-dimethoxyphenyl)-5-(5-methyl-1,3-thiazol-2-yl)-1,2,4-triazol-3-yl]-1-methoxy-1-(5-methylpyrimidin-2-yl)propane-2-sulfonamide |
| SMILES | COc1cccc(OC)c1-n1c(NS(=O)(=O)[C@@H](C)[C@H](OC)c2ncc(C)cn2)nnc1-c1ncc(C)s1 |
| InChI | InChI=1S/C23H27N7O5S2/c1-13-10-24-20(25-11-13)19(35-6)15(3)37(31,32)29-23-28-27-21(22-26-12-14(2)36-22)30(23)18-16(33-4)8-7-9-17(18)34-5/h7-12,15,19H,1-6H3,(H,28,29)/t15-,19-/m0/s1 |
| InChIKey | PQAVKYLLWSMVMM-KXBFYZLASA-N |
| XLogP | 3.33 |
| TPSA | 143.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.65 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |