C24H29N7O5S2 — CID 134542630
(1R,2S)-N-[4-(2,6-dimethoxyphenyl)-5-(4-methyl-1,3-thiazol-2-yl)-1,2,4-triazol-3-yl]-1-ethoxy-1-(5-methylpyrimidin-2-yl)propane-2-sulfonamide (PubChem CID 134542630) has the molecular formula C24H29N7O5S2 and a molecular weight of 559.67 g/mol. Its IUPAC name is (1R,2S)-N-[4-(2,6-dimethoxyphenyl)-5-(4-methyl-1,3-thiazol-2-yl)-1,2,4-triazol-3-yl]-1-ethoxy-1-(5-methylpyrimidin-2-yl)propane-2-sulfonamide.
| Compound Name | (1R,2S)-N-[4-(2,6-dimethoxyphenyl)-5-(4-methyl-1,3-thiazol-2-yl)-1,2,4-triazol-3-yl]-1-ethoxy-1-(5-methylpyrimidin-2-yl)propane-2-sulfonamide |
|---|---|
| PubChem CID | 134542630 |
| Molecular Formula | C24H29N7O5S2 |
| Molecular Weight | 559.67 g/mol |
| Exact Mass | 559.17 |
| IUPAC Name | (1R,2S)-N-[4-(2,6-dimethoxyphenyl)-5-(4-methyl-1,3-thiazol-2-yl)-1,2,4-triazol-3-yl]-1-ethoxy-1-(5-methylpyrimidin-2-yl)propane-2-sulfonamide |
| SMILES | CCO[C@H](c1ncc(C)cn1)[C@H](C)S(=O)(=O)Nc1nnc(-c2nc(C)cs2)n1-c1c(OC)cccc1OC |
| InChI | InChI=1S/C24H29N7O5S2/c1-7-36-20(21-25-11-14(2)12-26-21)16(4)38(32,33)30-24-29-28-22(23-27-15(3)13-37-23)31(24)19-17(34-5)9-8-10-18(19)35-6/h8-13,16,20H,7H2,1-6H3,(H,29,30)/t16-,20-/m0/s1 |
| InChIKey | XUOKNIJSFFLWJP-JXFKEZNVSA-N |
| XLogP | 3.72 |
| TPSA | 143.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.67 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |