C23H30N6O7S — CID 134542707
(3R,5S)-3-[[4-(2,6-dimethoxyphenyl)-5-(5-methylfuran-2-yl)-1,2,4-triazol-3-yl]sulfamoyl]-5-hydroxy-N,N-dimethylpiperidine-1-carboxamide (PubChem CID 134542707) has the molecular formula C23H30N6O7S and a molecular weight of 534.60 g/mol. Its IUPAC name is (3R,5S)-3-[[4-(2,6-dimethoxyphenyl)-5-(5-methylfuran-2-yl)-1,2,4-triazol-3-yl]sulfamoyl]-5-hydroxy-N,N-dimethylpiperidine-1-carboxamide.
| Compound Name | (3R,5S)-3-[[4-(2,6-dimethoxyphenyl)-5-(5-methylfuran-2-yl)-1,2,4-triazol-3-yl]sulfamoyl]-5-hydroxy-N,N-dimethylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 134542707 |
| Molecular Formula | C23H30N6O7S |
| Molecular Weight | 534.60 g/mol |
| Exact Mass | 534.19 |
| IUPAC Name | (3R,5S)-3-[[4-(2,6-dimethoxyphenyl)-5-(5-methylfuran-2-yl)-1,2,4-triazol-3-yl]sulfamoyl]-5-hydroxy-N,N-dimethylpiperidine-1-carboxamide |
| SMILES | COc1cccc(OC)c1-n1c(NS(=O)(=O)[C@@H]2C[C@H](O)CN(C(=O)N(C)C)C2)nnc1-c1ccc(C)o1 |
| InChI | InChI=1S/C23H30N6O7S/c1-14-9-10-19(36-14)21-24-25-22(29(21)20-17(34-4)7-6-8-18(20)35-5)26-37(32,33)16-11-15(30)12-28(13-16)23(31)27(2)3/h6-10,15-16,30H,11-13H2,1-5H3,(H,25,26)/t15-,16+/m0/s1 |
| InChIKey | DBJKMNOPNYXBFT-JKSUJKDBSA-N |
| XLogP | 1.71 |
| TPSA | 152.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.60 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |