About 2-[[(4R)-3,3-difluoropiperidin-4-yl]methylamino]pyrimidine-5-carbonitrile
2-[[(4R)-3,3-difluoropiperidin-4-yl]methylamino]pyrimidine-5-carbonitrile (PubChem CID 134542859) has the molecular formula C11H13F2N5
and a molecular weight of 253.26 g/mol. Its IUPAC name is 2-[[(4R)-3,3-difluoropiperidin-4-yl]methylamino]pyrimidine-5-carbonitrile.
Molecular Properties
| Compound Name | 2-[[(4R)-3,3-difluoropiperidin-4-yl]methylamino]pyrimidine-5-carbonitrile |
| PubChem CID | 134542859 |
| Molecular Formula | C11H13F2N5 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 2-[[(4R)-3,3-difluoropiperidin-4-yl]methylamino]pyrimidine-5-carbonitrile |
| SMILES | N#Cc1cnc(NC[C@H]2CCNCC2(F)F)nc1 |
| InChI | InChI=1S/C11H13F2N5/c12-11(13)7-15-2-1-9(11)6-18-10-16-4-8(3-14)5-17-10/h4-5,9,15H,1-2,6-7H2,(H,16,17,18)/t9-/m1/s1 |
| InChIKey | QHAABZRORYBUFC-SECBINFHSA-N |
| XLogP | 1.00 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[(4R)-3,3-difluoropiperidin-4-yl]methylamino]pyrimidine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(4R)-3,3-difluoropiperidin-4-yl]methylamino]pyrimidine-5-carbonitrile?
The IUPAC name of 2-[[(4R)-3,3-difluoropiperidin-4-yl]methylamino]pyrimidine-5-carbonitrile (CID 134542859) is 2-[[(4R)-3,3-difluoropiperidin-4-yl]methylamino]pyrimidine-5-carbonitrile.
What is the SMILES notation for 2-[[(4R)-3,3-difluoropiperidin-4-yl]methylamino]pyrimidine-5-carbonitrile?
The canonical SMILES for 2-[[(4R)-3,3-difluoropiperidin-4-yl]methylamino]pyrimidine-5-carbonitrile is N#Cc1cnc(NC[C@H]2CCNCC2(F)F)nc1.
What is the InChIKey of 2-[[(4R)-3,3-difluoropiperidin-4-yl]methylamino]pyrimidine-5-carbonitrile?
The InChIKey is QHAABZRORYBUFC-SECBINFHSA-N. The full InChI is InChI=1S/C11H13F2N5/c12-11(13)7-15-2-1-9(11)6-18-10-16-4-8(3-14)5-17-10/h4-5,9,15H,1-2,6-7H2,(H,16,17,18)/t9-/m1/s1.
What are the key properties of 2-[[(4R)-3,3-difluoropiperidin-4-yl]methylamino]pyrimidine-5-carbonitrile?
2-[[(4R)-3,3-difluoropiperidin-4-yl]methylamino]pyrimidine-5-carbonitrile has a molecular weight of 253.26 g/mol, XLogP of 1.00, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(4R)-3,3-difluoropiperidin-4-yl]methylamino]pyrimidine-5-carbonitrile is sourced from PubChem (CID 134542859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).