About N-[(3,3-difluoropiperidin-4-yl)methyl]pyridazin-3-amine
N-[(3,3-difluoropiperidin-4-yl)methyl]pyridazin-3-amine (PubChem CID 134542860) has the molecular formula C10H14F2N4
and a molecular weight of 228.25 g/mol. Its IUPAC name is N-[(3,3-difluoropiperidin-4-yl)methyl]pyridazin-3-amine.
Molecular Properties
| Compound Name | N-[(3,3-difluoropiperidin-4-yl)methyl]pyridazin-3-amine |
| PubChem CID | 134542860 |
| Molecular Formula | C10H14F2N4 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | N-[(3,3-difluoropiperidin-4-yl)methyl]pyridazin-3-amine |
| SMILES | FC1(F)CNCCC1CNc1cccnn1 |
| InChI | InChI=1S/C10H14F2N4/c11-10(12)7-13-5-3-8(10)6-14-9-2-1-4-15-16-9/h1-2,4,8,13H,3,5-7H2,(H,14,16) |
| InChIKey | FDPYGPZWCRZESV-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(3,3-difluoropiperidin-4-yl)methyl]pyridazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,3-difluoropiperidin-4-yl)methyl]pyridazin-3-amine?
The IUPAC name of N-[(3,3-difluoropiperidin-4-yl)methyl]pyridazin-3-amine (CID 134542860) is N-[(3,3-difluoropiperidin-4-yl)methyl]pyridazin-3-amine.
What is the SMILES notation for N-[(3,3-difluoropiperidin-4-yl)methyl]pyridazin-3-amine?
The canonical SMILES for N-[(3,3-difluoropiperidin-4-yl)methyl]pyridazin-3-amine is FC1(F)CNCCC1CNc1cccnn1.
What is the InChIKey of N-[(3,3-difluoropiperidin-4-yl)methyl]pyridazin-3-amine?
The InChIKey is FDPYGPZWCRZESV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14F2N4/c11-10(12)7-13-5-3-8(10)6-14-9-2-1-4-15-16-9/h1-2,4,8,13H,3,5-7H2,(H,14,16).
What are the key properties of N-[(3,3-difluoropiperidin-4-yl)methyl]pyridazin-3-amine?
N-[(3,3-difluoropiperidin-4-yl)methyl]pyridazin-3-amine has a molecular weight of 228.25 g/mol, XLogP of 1.13, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,3-difluoropiperidin-4-yl)methyl]pyridazin-3-amine is sourced from PubChem (CID 134542860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).