About (4-fluorophenyl)methyl 3,3-difluoro-4-[[(5-methylpyrazin-2-yl)amino]methyl]piperidine-1-carboxylate
(4-fluorophenyl)methyl 3,3-difluoro-4-[[(5-methylpyrazin-2-yl)amino]methyl]piperidine-1-carboxylate (PubChem CID 134542952) has the molecular formula C19H21F3N4O2
and a molecular weight of 394.40 g/mol. Its IUPAC name is (4-fluorophenyl)methyl 3,3-difluoro-4-[[(5-methylpyrazin-2-yl)amino]methyl]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | (4-fluorophenyl)methyl 3,3-difluoro-4-[[(5-methylpyrazin-2-yl)amino]methyl]piperidine-1-carboxylate |
| PubChem CID | 134542952 |
| Molecular Formula | C19H21F3N4O2 |
| Molecular Weight | 394.40 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | (4-fluorophenyl)methyl 3,3-difluoro-4-[[(5-methylpyrazin-2-yl)amino]methyl]piperidine-1-carboxylate |
| SMILES | Cc1cnc(NCC2CCN(C(=O)OCc3ccc(F)cc3)CC2(F)F)cn1 |
| InChI | InChI=1S/C19H21F3N4O2/c1-13-8-24-17(10-23-13)25-9-15-6-7-26(12-19(15,21)22)18(27)28-11-14-2-4-16(20)5-3-14/h2-5,8,10,15H,6-7,9,11-12H2,1H3,(H,24,25) |
| InChIKey | UBFRXKQJNNNOPB-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.40 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4-fluorophenyl)methyl 3,3-difluoro-4-[[(5-methylpyrazin-2-yl)amino]methyl]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-fluorophenyl)methyl 3,3-difluoro-4-[[(5-methylpyrazin-2-yl)amino]methyl]piperidine-1-carboxylate?
The IUPAC name of (4-fluorophenyl)methyl 3,3-difluoro-4-[[(5-methylpyrazin-2-yl)amino]methyl]piperidine-1-carboxylate (CID 134542952) is (4-fluorophenyl)methyl 3,3-difluoro-4-[[(5-methylpyrazin-2-yl)amino]methyl]piperidine-1-carboxylate.
What is the SMILES notation for (4-fluorophenyl)methyl 3,3-difluoro-4-[[(5-methylpyrazin-2-yl)amino]methyl]piperidine-1-carboxylate?
The canonical SMILES for (4-fluorophenyl)methyl 3,3-difluoro-4-[[(5-methylpyrazin-2-yl)amino]methyl]piperidine-1-carboxylate is Cc1cnc(NCC2CCN(C(=O)OCc3ccc(F)cc3)CC2(F)F)cn1.
What is the InChIKey of (4-fluorophenyl)methyl 3,3-difluoro-4-[[(5-methylpyrazin-2-yl)amino]methyl]piperidine-1-carboxylate?
The InChIKey is UBFRXKQJNNNOPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21F3N4O2/c1-13-8-24-17(10-23-13)25-9-15-6-7-26(12-19(15,21)22)18(27)28-11-14-2-4-16(20)5-3-14/h2-5,8,10,15H,6-7,9,11-12H2,1H3,(H,24,25).
What are the key properties of (4-fluorophenyl)methyl 3,3-difluoro-4-[[(5-methylpyrazin-2-yl)amino]methyl]piperidine-1-carboxylate?
(4-fluorophenyl)methyl 3,3-difluoro-4-[[(5-methylpyrazin-2-yl)amino]methyl]piperidine-1-carboxylate has a molecular weight of 394.40 g/mol, XLogP of 3.63, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-fluorophenyl)methyl 3,3-difluoro-4-[[(5-methylpyrazin-2-yl)amino]methyl]piperidine-1-carboxylate is sourced from PubChem (CID 134542952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).