C14H14N4O2S — CID 134543008
4-(2,6-dimethoxyphenyl)-5-thiophen-2-yl-1,2,4-triazol-3-amine (PubChem CID 134543008) has the molecular formula C14H14N4O2S and a molecular weight of 302.36 g/mol. Its IUPAC name is 4-(2,6-dimethoxyphenyl)-5-thiophen-2-yl-1,2,4-triazol-3-amine.
| Compound Name | 4-(2,6-dimethoxyphenyl)-5-thiophen-2-yl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 134543008 |
| Molecular Formula | C14H14N4O2S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 4-(2,6-dimethoxyphenyl)-5-thiophen-2-yl-1,2,4-triazol-3-amine |
| SMILES | COc1cccc(OC)c1-n1c(N)nnc1-c1cccs1 |
| InChI | InChI=1S/C14H14N4O2S/c1-19-9-5-3-6-10(20-2)12(9)18-13(16-17-14(18)15)11-7-4-8-21-11/h3-8H,1-2H3,(H2,15,17) |
| InChIKey | AZPUINZKUQBLBD-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |