C24H19F4N3O — CID 134543357
5-[(Z)-1-(6-ethoxy-3-pyridinyl)-4,4,4-trifluoro-2-phenylbut-1-enyl]-3-fluoro-2H-indazole (PubChem CID 134543357) has the molecular formula C24H19F4N3O and a molecular weight of 441.43 g/mol. Its IUPAC name is 5-[(Z)-1-(6-ethoxy-3-pyridinyl)-4,4,4-trifluoro-2-phenylbut-1-enyl]-3-fluoro-2H-indazole.
| Compound Name | 5-[(Z)-1-(6-ethoxy-3-pyridinyl)-4,4,4-trifluoro-2-phenylbut-1-enyl]-3-fluoro-2H-indazole |
|---|---|
| PubChem CID | 134543357 |
| Molecular Formula | C24H19F4N3O |
| Molecular Weight | 441.43 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | 5-[(Z)-1-(6-ethoxy-3-pyridinyl)-4,4,4-trifluoro-2-phenylbut-1-enyl]-3-fluoro-2H-indazole |
| SMILES | CCOc1ccc(/C(=C(/CC(F)(F)F)c2ccccc2)c2ccc3n[nH]c(F)c3c2)cn1 |
| InChI | InChI=1S/C24H19F4N3O/c1-2-32-21-11-9-17(14-29-21)22(16-8-10-20-18(12-16)23(25)31-30-20)19(13-24(26,27)28)15-6-4-3-5-7-15/h3-12,14H,2,13H2,1H3,(H,30,31)/b22-19- |
| InChIKey | VOOGAWNJSYZIOU-QOCHGBHMSA-N |
| XLogP | 6.41 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.43 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|