C20H24F3N3O5S — CID 134543454
(4-fluorophenyl)methyl (4R)-3,3-difluoro-4-[(pyridin-4-ylamino)methyl]piperidine-1-carboxylate;methanesulfonic acid (PubChem CID 134543454) has the molecular formula C20H24F3N3O5S and a molecular weight of 475.49 g/mol. Its IUPAC name is (4-fluorophenyl)methyl (4R)-3,3-difluoro-4-[(pyridin-4-ylamino)methyl]piperidine-1-carboxylate;methanesulfonic acid.
| Compound Name | (4-fluorophenyl)methyl (4R)-3,3-difluoro-4-[(pyridin-4-ylamino)methyl]piperidine-1-carboxylate;methanesulfonic acid |
|---|---|
| PubChem CID | 134543454 |
| Molecular Formula | C20H24F3N3O5S |
| Molecular Weight | 475.49 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | (4-fluorophenyl)methyl (4R)-3,3-difluoro-4-[(pyridin-4-ylamino)methyl]piperidine-1-carboxylate;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.O=C(OCc1ccc(F)cc1)N1CC[C@H](CNc2ccncc2)C(F)(F)C1 |
| InChI | InChI=1S/C19H20F3N3O2.CH4O3S/c20-16-3-1-14(2-4-16)12-27-18(26)25-10-7-15(19(21,22)13-25)11-24-17-5-8-23-9-6-17;1-5(2,3)4/h1-6,8-9,15H,7,10-13H2,(H,23,24);1H3,(H,2,3,4)/t15-;/m1./s1 |
| InChIKey | UMPIGAOLROHTGK-XFULWGLBSA-N |
| XLogP | 3.43 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.49 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|