C23H30N6O6S — CID 134543483
N-[4-(2,6-dimethoxyphenyl)-5-(5-methylfuran-2-yl)-1,2,4-triazol-3-yl]-2-[(6R)-3,6-dimethyl-2-oxo-1,3-diazinan-1-yl]ethanesulfonamide (PubChem CID 134543483) has the molecular formula C23H30N6O6S and a molecular weight of 518.60 g/mol. Its IUPAC name is N-[4-(2,6-dimethoxyphenyl)-5-(5-methylfuran-2-yl)-1,2,4-triazol-3-yl]-2-[(6R)-3,6-dimethyl-2-oxo-1,3-diazinan-1-yl]ethanesulfonamide.
| Compound Name | N-[4-(2,6-dimethoxyphenyl)-5-(5-methylfuran-2-yl)-1,2,4-triazol-3-yl]-2-[(6R)-3,6-dimethyl-2-oxo-1,3-diazinan-1-yl]ethanesulfonamide |
|---|---|
| PubChem CID | 134543483 |
| Molecular Formula | C23H30N6O6S |
| Molecular Weight | 518.60 g/mol |
| Exact Mass | 518.19 |
| IUPAC Name | N-[4-(2,6-dimethoxyphenyl)-5-(5-methylfuran-2-yl)-1,2,4-triazol-3-yl]-2-[(6R)-3,6-dimethyl-2-oxo-1,3-diazinan-1-yl]ethanesulfonamide |
| SMILES | COc1cccc(OC)c1-n1c(NS(=O)(=O)CCN2C(=O)N(C)CC[C@H]2C)nnc1-c1ccc(C)o1 |
| InChI | InChI=1S/C23H30N6O6S/c1-15-11-12-27(3)23(30)28(15)13-14-36(31,32)26-22-25-24-21(19-10-9-16(2)35-19)29(22)20-17(33-4)7-6-8-18(20)34-5/h6-10,15H,11-14H2,1-5H3,(H,25,26)/t15-/m1/s1 |
| InChIKey | IJUMSXRMJLCNKA-OAHLLOKOSA-N |
| XLogP | 2.74 |
| TPSA | 132.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.60 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |