C26H32N6O8S — CID 134543533
(1R,2R)-1-[(2S)-2,3-dihydroxypropoxy]-N-[4-(2,6-dimethoxyphenyl)-5-(5-methylfuran-2-yl)-1,2,4-triazol-3-yl]-1-(5-methylpyrimidin-2-yl)propane-2-sulfonamide (PubChem CID 134543533) has the molecular formula C26H32N6O8S and a molecular weight of 588.64 g/mol. Its IUPAC name is (1R,2R)-1-[(2S)-2,3-dihydroxypropoxy]-N-[4-(2,6-dimethoxyphenyl)-5-(5-methylfuran-2-yl)-1,2,4-triazol-3-yl]-1-(5-methylpyrimidin-2-yl)propane-2-sulfonamide.
| Compound Name | (1R,2R)-1-[(2S)-2,3-dihydroxypropoxy]-N-[4-(2,6-dimethoxyphenyl)-5-(5-methylfuran-2-yl)-1,2,4-triazol-3-yl]-1-(5-methylpyrimidin-2-yl)propane-2-sulfonamide |
|---|---|
| PubChem CID | 134543533 |
| Molecular Formula | C26H32N6O8S |
| Molecular Weight | 588.64 g/mol |
| Exact Mass | 588.20 |
| IUPAC Name | (1R,2R)-1-[(2S)-2,3-dihydroxypropoxy]-N-[4-(2,6-dimethoxyphenyl)-5-(5-methylfuran-2-yl)-1,2,4-triazol-3-yl]-1-(5-methylpyrimidin-2-yl)propane-2-sulfonamide |
| SMILES | COc1cccc(OC)c1-n1c(NS(=O)(=O)[C@H](C)[C@H](OC[C@@H](O)CO)c2ncc(C)cn2)nnc1-c1ccc(C)o1 |
| InChI | InChI=1S/C26H32N6O8S/c1-15-11-27-24(28-12-15)23(39-14-18(34)13-33)17(3)41(35,36)31-26-30-29-25(21-10-9-16(2)40-21)32(26)22-19(37-4)7-6-8-20(22)38-5/h6-12,17-18,23,33-34H,13-14H2,1-5H3,(H,30,31)/t17-,18+,23+/m1/s1 |
| InChIKey | IVDFAJVDXASFHO-STSQHVNTSA-N |
| XLogP | 2.19 |
| TPSA | 183.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.64 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |