About US10736883, Example 339.0
US10736883, Example 339.0 (PubChem CID 134543952) has the molecular formula C22H29N5O7S2
and a molecular weight of 539.60 g/mol. Its IUPAC name is (3R)-N-[4-(2,6-dimethoxyphenyl)-5-(furan-2-yl)-1,2,4-triazol-3-yl]-1-propan-2-ylsulfonylpiperidine-3-sulfonamide.
Molecular Properties
| Compound Name | US10736883, Example 339.0 |
| PubChem CID | 134543952 |
| Molecular Formula | C22H29N5O7S2 |
| Molecular Weight | 539.60 g/mol |
| Exact Mass | 539.15 |
| IUPAC Name | (3R)-N-[4-(2,6-dimethoxyphenyl)-5-(furan-2-yl)-1,2,4-triazol-3-yl]-1-propan-2-ylsulfonylpiperidine-3-sulfonamide |
| SMILES | CC(C)S(=O)(=O)N1CCC[C@H](C1)S(=O)(=O)NC2=NN=C(N2C3=C(C=CC=C3OC)OC)C4=CC=CO4 |
| InChI | InChI=1S/C22H29N5O7S2/c1-15(2)36(30,31)26-12-6-8-16(14-26)35(28,29)25-22-24-23-21(19-11-7-13-34-19)27(22)20-17(32-3)9-5-10-18(20)33-4/h5,7,9-11,13,15-16H,6,8,12,14H2,1-4H3,(H,24,25)/t16-/m1/s1 |
| InChIKey | LCSDVEKBGNKACZ-MRXNPFEDSA-N |
| XLogP | 1.70 |
| TPSA | 163.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | 927 |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 539.60 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
Analyze US10736883, Example 339.0 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of US10736883, Example 339.0?
The IUPAC name of US10736883, Example 339.0 (CID 134543952) is (3R)-N-[4-(2,6-dimethoxyphenyl)-5-(furan-2-yl)-1,2,4-triazol-3-yl]-1-propan-2-ylsulfonylpiperidine-3-sulfonamide.
What is the SMILES notation for US10736883, Example 339.0?
The canonical SMILES for US10736883, Example 339.0 is CC(C)S(=O)(=O)N1CCC[C@H](C1)S(=O)(=O)NC2=NN=C(N2C3=C(C=CC=C3OC)OC)C4=CC=CO4.
What is the InChIKey of US10736883, Example 339.0?
The InChIKey is LCSDVEKBGNKACZ-MRXNPFEDSA-N. The full InChI is InChI=1S/C22H29N5O7S2/c1-15(2)36(30,31)26-12-6-8-16(14-26)35(28,29)25-22-24-23-21(19-11-7-13-34-19)27(22)20-17(32-3)9-5-10-18(20)33-4/h5,7,9-11,13,15-16H,6,8,12,14H2,1-4H3,(H,24,25)/t16-/m1/s1.
What are the key properties of US10736883, Example 339.0?
US10736883, Example 339.0 has a molecular weight of 539.60 g/mol, XLogP of 1.70, 9 rotatable bonds, 1 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for US10736883, Example 339.0 is sourced from PubChem (CID 134543952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).