About methyl 2-bromo-3,4,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylate
methyl 2-bromo-3,4,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylate (PubChem CID 134544084) has the molecular formula C13H9BrO6
and a molecular weight of 341.11 g/mol. Its IUPAC name is methyl 2-bromo-3,4,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylate.
Molecular Properties
| Compound Name | methyl 2-bromo-3,4,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylate |
| PubChem CID | 134544084 |
| Molecular Formula | C13H9BrO6 |
| Molecular Weight | 341.11 g/mol |
| Exact Mass | 339.96 |
| IUPAC Name | methyl 2-bromo-3,4,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylate |
| SMILES | COC(=O)c1cc(=O)c(O)c2c(O)c(O)c(Br)cc2c1 |
| InChI | InChI=1S/C13H9BrO6/c1-20-13(19)6-2-5-3-7(14)10(16)12(18)9(5)11(17)8(15)4-6/h2-4,16,18H,1H3,(H,15,17) |
| InChIKey | YGMIMBRCJYLGTQ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.11 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-bromo-3,4,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-bromo-3,4,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylate?
The IUPAC name of methyl 2-bromo-3,4,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylate (CID 134544084) is methyl 2-bromo-3,4,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylate.
What is the SMILES notation for methyl 2-bromo-3,4,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylate?
The canonical SMILES for methyl 2-bromo-3,4,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylate is COC(=O)c1cc(=O)c(O)c2c(O)c(O)c(Br)cc2c1.
What is the InChIKey of methyl 2-bromo-3,4,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylate?
The InChIKey is YGMIMBRCJYLGTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9BrO6/c1-20-13(19)6-2-5-3-7(14)10(16)12(18)9(5)11(17)8(15)4-6/h2-4,16,18H,1H3,(H,15,17).
What are the key properties of methyl 2-bromo-3,4,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylate?
methyl 2-bromo-3,4,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylate has a molecular weight of 341.11 g/mol, XLogP of 1.87, 1 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-bromo-3,4,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylate is sourced from PubChem (CID 134544084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).