C20H21F2N7O3 — CID 134544236
N-[1-[2-(2,2-difluoroethoxy)ethyl]-3-pyridin-2-ylpyrazol-4-yl]-2-[(E)-1-(2-methylidenehydrazinyl)prop-1-en-2-yl]-1,3-oxazole-4-carboxamide (PubChem CID 134544236) has the molecular formula C20H21F2N7O3 and a molecular weight of 445.43 g/mol. Its IUPAC name is N-[1-[2-(2,2-difluoroethoxy)ethyl]-3-pyridin-2-ylpyrazol-4-yl]-2-[(E)-1-(2-methylidenehydrazinyl)prop-1-en-2-yl]-1,3-oxazole-4-carboxamide.
| Compound Name | N-[1-[2-(2,2-difluoroethoxy)ethyl]-3-pyridin-2-ylpyrazol-4-yl]-2-[(E)-1-(2-methylidenehydrazinyl)prop-1-en-2-yl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 134544236 |
| Molecular Formula | C20H21F2N7O3 |
| Molecular Weight | 445.43 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | N-[1-[2-(2,2-difluoroethoxy)ethyl]-3-pyridin-2-ylpyrazol-4-yl]-2-[(E)-1-(2-methylidenehydrazinyl)prop-1-en-2-yl]-1,3-oxazole-4-carboxamide |
| SMILES | C=NN/C=C(\C)c1nc(C(=O)Nc2cn(CCOCC(F)F)nc2-c2ccccn2)co1 |
| InChI | InChI=1S/C20H21F2N7O3/c1-13(9-25-23-2)20-27-16(11-32-20)19(30)26-15-10-29(7-8-31-12-17(21)22)28-18(15)14-5-3-4-6-24-14/h3-6,9-11,17,25H,2,7-8,12H2,1H3,(H,26,30)/b13-9+ |
| InChIKey | SYIUNIKZGZRZJN-UKTHLTGXSA-N |
| XLogP | 3.03 |
| TPSA | 119.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.43 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|