C28H34F4N4O — CID 134544770
3-[(3R)-1-[4-[(1-butylazetidin-3-yl)amino]-2,6-difluorophenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2,2-difluoropropan-1-ol (PubChem CID 134544770) has the molecular formula C28H34F4N4O and a molecular weight of 518.60 g/mol. Its IUPAC name is 3-[(3R)-1-[4-[(1-butylazetidin-3-yl)amino]-2,6-difluorophenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2,2-difluoropropan-1-ol.
| Compound Name | 3-[(3R)-1-[4-[(1-butylazetidin-3-yl)amino]-2,6-difluorophenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2,2-difluoropropan-1-ol |
|---|---|
| PubChem CID | 134544770 |
| Molecular Formula | C28H34F4N4O |
| Molecular Weight | 518.60 g/mol |
| Exact Mass | 518.27 |
| IUPAC Name | 3-[(3R)-1-[4-[(1-butylazetidin-3-yl)amino]-2,6-difluorophenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2,2-difluoropropan-1-ol |
| SMILES | CCCCN1CC(Nc2cc(F)c(C3c4[nH]c5ccccc5c4C[C@@H](C)N3CC(F)(F)CO)c(F)c2)C1 |
| InChI | InChI=1S/C28H34F4N4O/c1-3-4-9-35-13-19(14-35)33-18-11-22(29)25(23(30)12-18)27-26-21(20-7-5-6-8-24(20)34-26)10-17(2)36(27)15-28(31,32)16-37/h5-8,11-12,17,19,27,33-34,37H,3-4,9-10,13-16H2,1-2H3/t17-,27?/m1/s1 |
| InChIKey | AACQUKSAZBPAQQ-MOJDWNGGSA-N |
| XLogP | 5.31 |
| TPSA | 54.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.60 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|