C21H21ClFNO4S — CID 13454500
cyclopentyl 2-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluorophenyl]sulfanylacetate (PubChem CID 13454500) has the molecular formula C21H21ClFNO4S and a molecular weight of 437.92 g/mol. Its IUPAC name is cyclopentyl 2-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluorophenyl]sulfanylacetate.
| Compound Name | cyclopentyl 2-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluorophenyl]sulfanylacetate |
|---|---|
| PubChem CID | 13454500 |
| Molecular Formula | C21H21ClFNO4S |
| Molecular Weight | 437.92 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | cyclopentyl 2-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluorophenyl]sulfanylacetate |
| SMILES | O=C(CSc1cc(N2C(=O)C3=C(CCCC3)C2=O)c(F)cc1Cl)OC1CCCC1 |
| InChI | InChI=1S/C21H21ClFNO4S/c22-15-9-16(23)17(24-20(26)13-7-3-4-8-14(13)21(24)27)10-18(15)29-11-19(25)28-12-5-1-2-6-12/h9-10,12H,1-8,11H2 |
| InChIKey | AWSBUTCRSNBEDG-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.92 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|