C27H27F2N5O — CID 134545682
(1S)-N-(5-cyano-2-pyridinyl)-3-[(3Z)-4-(2,6-difluorophenyl)-4-(ethenyldiazenyl)buta-1,3-dien-2-yl]-1,2,2-trimethylcyclopentane-1-carboxamide (PubChem CID 134545682) has the molecular formula C27H27F2N5O and a molecular weight of 475.54 g/mol. Its IUPAC name is (1S)-N-(5-cyano-2-pyridinyl)-3-[(3Z)-4-(2,6-difluorophenyl)-4-(ethenyldiazenyl)buta-1,3-dien-2-yl]-1,2,2-trimethylcyclopentane-1-carboxamide.
| Compound Name | (1S)-N-(5-cyano-2-pyridinyl)-3-[(3Z)-4-(2,6-difluorophenyl)-4-(ethenyldiazenyl)buta-1,3-dien-2-yl]-1,2,2-trimethylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 134545682 |
| Molecular Formula | C27H27F2N5O |
| Molecular Weight | 475.54 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | (1S)-N-(5-cyano-2-pyridinyl)-3-[(3Z)-4-(2,6-difluorophenyl)-4-(ethenyldiazenyl)buta-1,3-dien-2-yl]-1,2,2-trimethylcyclopentane-1-carboxamide |
| SMILES | C=C/N=N/C(=C\C(=C)C1CC[C@](C)(C(=O)Nc2ccc(C#N)cn2)C1(C)C)c1c(F)cccc1F |
| InChI | InChI=1S/C27H27F2N5O/c1-6-32-34-22(24-20(28)8-7-9-21(24)29)14-17(2)19-12-13-27(5,26(19,3)4)25(35)33-23-11-10-18(15-30)16-31-23/h6-11,14,16,19H,1-2,12-13H2,3-5H3,(H,31,33,35)/b22-14-,34-32+/t19?,27-/m1/s1 |
| InChIKey | BIBGUHUZXGVCGS-BAZSQFNZSA-N |
| XLogP | 6.81 |
| TPSA | 90.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.54 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|