C27H33F2N3O — CID 134545699
2-azaspiro[3.3]heptan-2-yl-[(1S)-3-[(3Z)-4-(2,6-difluorophenyl)-4-(ethenyldiazenyl)buta-1,3-dien-2-yl]-1,2,2-trimethylcyclopentyl]methanone (PubChem CID 134545699) has the molecular formula C27H33F2N3O and a molecular weight of 453.58 g/mol. Its IUPAC name is 2-azaspiro[3.3]heptan-2-yl-[(1S)-3-[(3Z)-4-(2,6-difluorophenyl)-4-(ethenyldiazenyl)buta-1,3-dien-2-yl]-1,2,2-trimethylcyclopentyl]methanone.
| Compound Name | 2-azaspiro[3.3]heptan-2-yl-[(1S)-3-[(3Z)-4-(2,6-difluorophenyl)-4-(ethenyldiazenyl)buta-1,3-dien-2-yl]-1,2,2-trimethylcyclopentyl]methanone |
|---|---|
| PubChem CID | 134545699 |
| Molecular Formula | C27H33F2N3O |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.26 |
| IUPAC Name | 2-azaspiro[3.3]heptan-2-yl-[(1S)-3-[(3Z)-4-(2,6-difluorophenyl)-4-(ethenyldiazenyl)buta-1,3-dien-2-yl]-1,2,2-trimethylcyclopentyl]methanone |
| SMILES | C=C/N=N/C(=C\C(=C)C1CC[C@](C)(C(=O)N2CC3(CCC3)C2)C1(C)C)c1c(F)cccc1F |
| InChI | InChI=1S/C27H33F2N3O/c1-6-30-31-22(23-20(28)9-7-10-21(23)29)15-18(2)19-11-14-26(5,25(19,3)4)24(33)32-16-27(17-32)12-8-13-27/h6-7,9-10,15,19H,1-2,8,11-14,16-17H2,3-5H3/b22-15-,31-30+/t19?,26-/m1/s1 |
| InChIKey | OQWFZHFQLZPTCX-AWGQOOFQSA-N |
| XLogP | 6.91 |
| TPSA | 45.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|