C42H52N8O8 — CID 134546052
ethyl 5-[4,8,11-tris(5-ethoxycarbonyl-3-pyridinyl)-1,4,8,11-tetrazacyclotetradec-1-yl]pyridine-3-carboxylate (PubChem CID 134546052) has the molecular formula C42H52N8O8 and a molecular weight of 796.93 g/mol. Its IUPAC name is ethyl 5-[4,8,11-tris(5-ethoxycarbonyl-3-pyridinyl)-1,4,8,11-tetrazacyclotetradec-1-yl]pyridine-3-carboxylate.
| Compound Name | ethyl 5-[4,8,11-tris(5-ethoxycarbonyl-3-pyridinyl)-1,4,8,11-tetrazacyclotetradec-1-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 134546052 |
| Molecular Formula | C42H52N8O8 |
| Molecular Weight | 796.93 g/mol |
| Exact Mass | 796.39 |
| IUPAC Name | ethyl 5-[4,8,11-tris(5-ethoxycarbonyl-3-pyridinyl)-1,4,8,11-tetrazacyclotetradec-1-yl]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cncc(N2CCCN(c3cncc(C(=O)OCC)c3)CCN(c3cncc(C(=O)OCC)c3)CCCN(c3cncc(C(=O)OCC)c3)CC2)c1 |
| InChI | InChI=1S/C42H52N8O8/c1-5-55-39(51)31-19-35(27-43-23-31)47-11-9-12-49(37-21-33(25-45-29-37)41(53)57-7-3)17-18-50(38-22-34(26-46-30-38)42(54)58-8-4)14-10-13-48(16-15-47)36-20-32(24-44-28-36)40(52)56-6-2/h19-30H,5-18H2,1-4H3 |
| InChIKey | OQUATGZDVMWRAJ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 169.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.93 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|