C15H17N3O5S — CID 134546469
6-[[(1E,3E)-3-formyl-1-(methylideneamino)penta-1,3-dien-2-yl]oxymethyl]-N-methylsulfonylpyridine-3-carboxamide (PubChem CID 134546469) has the molecular formula C15H17N3O5S and a molecular weight of 351.38 g/mol. Its IUPAC name is 6-[[(1E,3E)-3-formyl-1-(methylideneamino)penta-1,3-dien-2-yl]oxymethyl]-N-methylsulfonylpyridine-3-carboxamide.
| Compound Name | 6-[[(1E,3E)-3-formyl-1-(methylideneamino)penta-1,3-dien-2-yl]oxymethyl]-N-methylsulfonylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 134546469 |
| Molecular Formula | C15H17N3O5S |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 6-[[(1E,3E)-3-formyl-1-(methylideneamino)penta-1,3-dien-2-yl]oxymethyl]-N-methylsulfonylpyridine-3-carboxamide |
| SMILES | C=N/C=C(OCc1ccc(C(=O)NS(C)(=O)=O)cn1)\C(C=O)=C/C |
| InChI | InChI=1S/C15H17N3O5S/c1-4-11(9-19)14(8-16-2)23-10-13-6-5-12(7-17-13)15(20)18-24(3,21)22/h4-9H,2,10H2,1,3H3,(H,18,20)/b11-4-,14-8+ |
| InChIKey | IVTFZHCENKUWFK-CIIXZHJPSA-N |
| XLogP | 0.97 |
| TPSA | 114.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|