About 4-butyl-6-propan-2-yl-1,4-dihydropyrimidine
4-butyl-6-propan-2-yl-1,4-dihydropyrimidine (PubChem CID 134546559) has the molecular formula C11H20N2
and a molecular weight of 180.29 g/mol. Its IUPAC name is 4-butyl-6-propan-2-yl-1,4-dihydropyrimidine.
Molecular Properties
| Compound Name | 4-butyl-6-propan-2-yl-1,4-dihydropyrimidine |
| PubChem CID | 134546559 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 4-butyl-6-propan-2-yl-1,4-dihydropyrimidine |
| SMILES | CCCCC1C=C(C(C)C)NC=N1 |
| InChI | InChI=1S/C11H20N2/c1-4-5-6-10-7-11(9(2)3)13-8-12-10/h7-10H,4-6H2,1-3H3,(H,12,13) |
| InChIKey | IXHXDIGBGSVTHD-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-butyl-6-propan-2-yl-1,4-dihydropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butyl-6-propan-2-yl-1,4-dihydropyrimidine?
The IUPAC name of 4-butyl-6-propan-2-yl-1,4-dihydropyrimidine (CID 134546559) is 4-butyl-6-propan-2-yl-1,4-dihydropyrimidine.
What is the SMILES notation for 4-butyl-6-propan-2-yl-1,4-dihydropyrimidine?
The canonical SMILES for 4-butyl-6-propan-2-yl-1,4-dihydropyrimidine is CCCCC1C=C(C(C)C)NC=N1.
What is the InChIKey of 4-butyl-6-propan-2-yl-1,4-dihydropyrimidine?
The InChIKey is IXHXDIGBGSVTHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2/c1-4-5-6-10-7-11(9(2)3)13-8-12-10/h7-10H,4-6H2,1-3H3,(H,12,13).
What are the key properties of 4-butyl-6-propan-2-yl-1,4-dihydropyrimidine?
4-butyl-6-propan-2-yl-1,4-dihydropyrimidine has a molecular weight of 180.29 g/mol, XLogP of 2.72, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butyl-6-propan-2-yl-1,4-dihydropyrimidine is sourced from PubChem (CID 134546559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).