C21H18F3N5O — CID 134546599
[6-[2-(6-methyl-2-pyridinyl)-3-pyridinyl]imidazo[1,2-a]pyridin-3-yl]-(2,2,2-trifluoroethylamino)methanol (PubChem CID 134546599) has the molecular formula C21H18F3N5O and a molecular weight of 413.40 g/mol. Its IUPAC name is [6-[2-(6-methyl-2-pyridinyl)-3-pyridinyl]imidazo[1,2-a]pyridin-3-yl]-(2,2,2-trifluoroethylamino)methanol.
| Compound Name | [6-[2-(6-methyl-2-pyridinyl)-3-pyridinyl]imidazo[1,2-a]pyridin-3-yl]-(2,2,2-trifluoroethylamino)methanol |
|---|---|
| PubChem CID | 134546599 |
| Molecular Formula | C21H18F3N5O |
| Molecular Weight | 413.40 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | [6-[2-(6-methyl-2-pyridinyl)-3-pyridinyl]imidazo[1,2-a]pyridin-3-yl]-(2,2,2-trifluoroethylamino)methanol |
| SMILES | Cc1cccc(-c2ncccc2-c2ccc3ncc(C(O)NCC(F)(F)F)n3c2)n1 |
| InChI | InChI=1S/C21H18F3N5O/c1-13-4-2-6-16(28-13)19-15(5-3-9-25-19)14-7-8-18-26-10-17(29(18)11-14)20(30)27-12-21(22,23)24/h2-11,20,27,30H,12H2,1H3 |
| InChIKey | ZLXKMGAQLRHZDW-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.40 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|