About 2-tert-butyl-3-(3,3-dimethylbutan-2-yl)-4,6-dimethylbenzenethiol
2-tert-butyl-3-(3,3-dimethylbutan-2-yl)-4,6-dimethylbenzenethiol (PubChem CID 134546600) has the molecular formula C18H30S
and a molecular weight of 278.50 g/mol. Its IUPAC name is 2-tert-butyl-3-(3,3-dimethylbutan-2-yl)-4,6-dimethylbenzenethiol.
Molecular Properties
| Compound Name | 2-tert-butyl-3-(3,3-dimethylbutan-2-yl)-4,6-dimethylbenzenethiol |
| PubChem CID | 134546600 |
| Molecular Formula | C18H30S |
| Molecular Weight | 278.50 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | 2-tert-butyl-3-(3,3-dimethylbutan-2-yl)-4,6-dimethylbenzenethiol |
| SMILES | Cc1cc(C)c(C(C)C(C)(C)C)c(C(C)(C)C)c1S |
| InChI | InChI=1S/C18H30S/c1-11-10-12(2)16(19)15(18(7,8)9)14(11)13(3)17(4,5)6/h10,13,19H,1-9H3 |
| InChIKey | JOEHYHUEWUEWTA-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 278.50 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-butyl-3-(3,3-dimethylbutan-2-yl)-4,6-dimethylbenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-3-(3,3-dimethylbutan-2-yl)-4,6-dimethylbenzenethiol?
The IUPAC name of 2-tert-butyl-3-(3,3-dimethylbutan-2-yl)-4,6-dimethylbenzenethiol (CID 134546600) is 2-tert-butyl-3-(3,3-dimethylbutan-2-yl)-4,6-dimethylbenzenethiol.
What is the SMILES notation for 2-tert-butyl-3-(3,3-dimethylbutan-2-yl)-4,6-dimethylbenzenethiol?
The canonical SMILES for 2-tert-butyl-3-(3,3-dimethylbutan-2-yl)-4,6-dimethylbenzenethiol is Cc1cc(C)c(C(C)C(C)(C)C)c(C(C)(C)C)c1S.
What is the InChIKey of 2-tert-butyl-3-(3,3-dimethylbutan-2-yl)-4,6-dimethylbenzenethiol?
The InChIKey is JOEHYHUEWUEWTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30S/c1-11-10-12(2)16(19)15(18(7,8)9)14(11)13(3)17(4,5)6/h10,13,19H,1-9H3.
What are the key properties of 2-tert-butyl-3-(3,3-dimethylbutan-2-yl)-4,6-dimethylbenzenethiol?
2-tert-butyl-3-(3,3-dimethylbutan-2-yl)-4,6-dimethylbenzenethiol has a molecular weight of 278.50 g/mol, XLogP of 6.04, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-3-(3,3-dimethylbutan-2-yl)-4,6-dimethylbenzenethiol is sourced from PubChem (CID 134546600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).