About 4-methyl-1-N'-(2-methylpentyl)pent-4-ene-1,1-diamine
4-methyl-1-N'-(2-methylpentyl)pent-4-ene-1,1-diamine (PubChem CID 134546937) has the molecular formula C12H26N2
and a molecular weight of 198.35 g/mol. Its IUPAC name is 4-methyl-1-N'-(2-methylpentyl)pent-4-ene-1,1-diamine.
Molecular Properties
| Compound Name | 4-methyl-1-N'-(2-methylpentyl)pent-4-ene-1,1-diamine |
| PubChem CID | 134546937 |
| Molecular Formula | C12H26N2 |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.21 |
| IUPAC Name | 4-methyl-1-N'-(2-methylpentyl)pent-4-ene-1,1-diamine |
| SMILES | C=C(C)CCC(N)NCC(C)CCC |
| InChI | InChI=1S/C12H26N2/c1-5-6-11(4)9-14-12(13)8-7-10(2)3/h11-12,14H,2,5-9,13H2,1,3-4H3 |
| InChIKey | RHZDSSAYUPZOEA-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-1-N'-(2-methylpentyl)pent-4-ene-1,1-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1-N'-(2-methylpentyl)pent-4-ene-1,1-diamine?
The IUPAC name of 4-methyl-1-N'-(2-methylpentyl)pent-4-ene-1,1-diamine (CID 134546937) is 4-methyl-1-N'-(2-methylpentyl)pent-4-ene-1,1-diamine.
What is the SMILES notation for 4-methyl-1-N'-(2-methylpentyl)pent-4-ene-1,1-diamine?
The canonical SMILES for 4-methyl-1-N'-(2-methylpentyl)pent-4-ene-1,1-diamine is C=C(C)CCC(N)NCC(C)CCC.
What is the InChIKey of 4-methyl-1-N'-(2-methylpentyl)pent-4-ene-1,1-diamine?
The InChIKey is RHZDSSAYUPZOEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26N2/c1-5-6-11(4)9-14-12(13)8-7-10(2)3/h11-12,14H,2,5-9,13H2,1,3-4H3.
What are the key properties of 4-methyl-1-N'-(2-methylpentyl)pent-4-ene-1,1-diamine?
4-methyl-1-N'-(2-methylpentyl)pent-4-ene-1,1-diamine has a molecular weight of 198.35 g/mol, XLogP of 2.65, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1-N'-(2-methylpentyl)pent-4-ene-1,1-diamine is sourced from PubChem (CID 134546937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).