C15H18N2O4 — CID 134547043
N-[(5-methylfuran-2-yl)methyl]-3-[(5-methylfuran-2-yl)methylamino]oxirane-2-carboxamide (PubChem CID 134547043) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is N-[(5-methylfuran-2-yl)methyl]-3-[(5-methylfuran-2-yl)methylamino]oxirane-2-carboxamide.
| Compound Name | N-[(5-methylfuran-2-yl)methyl]-3-[(5-methylfuran-2-yl)methylamino]oxirane-2-carboxamide |
|---|---|
| PubChem CID | 134547043 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | N-[(5-methylfuran-2-yl)methyl]-3-[(5-methylfuran-2-yl)methylamino]oxirane-2-carboxamide |
| SMILES | Cc1ccc(CNC(=O)C2OC2NCc2ccc(C)o2)o1 |
| InChI | InChI=1S/C15H18N2O4/c1-9-3-5-11(19-9)7-16-14(18)13-15(21-13)17-8-12-6-4-10(2)20-12/h3-6,13,15,17H,7-8H2,1-2H3,(H,16,18) |
| InChIKey | XREATGIUCUZOQC-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 79.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|