C21H29FN5O14P — CID 134547127
[[(2R,3R,4R,5R)-2-(1-azidoethenyl)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-(propan-2-yloxycarbonyloxymethoxy)phosphoryl]oxymethyl propan-2-yl carbonate (PubChem CID 134547127) has the molecular formula C21H29FN5O14P and a molecular weight of 625.46 g/mol. Its IUPAC name is [[(2R,3R,4R,5R)-2-(1-azidoethenyl)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-(propan-2-yloxycarbonyloxymethoxy)phosphoryl]oxymethyl propan-2-yl carbonate.
| Compound Name | [[(2R,3R,4R,5R)-2-(1-azidoethenyl)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-(propan-2-yloxycarbonyloxymethoxy)phosphoryl]oxymethyl propan-2-yl carbonate |
|---|---|
| PubChem CID | 134547127 |
| Molecular Formula | C21H29FN5O14P |
| Molecular Weight | 625.46 g/mol |
| Exact Mass | 625.14 |
| IUPAC Name | [[(2R,3R,4R,5R)-2-(1-azidoethenyl)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-(propan-2-yloxycarbonyloxymethoxy)phosphoryl]oxymethyl propan-2-yl carbonate |
| SMILES | C=C(N=[N+]=[N-])[C@]1(COP(=O)(OCOC(=O)OC(C)C)OCOC(=O)OC(C)C)O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](F)[C@@H]1O |
| InChI | InChI=1S/C21H29FN5O14P/c1-11(2)39-19(31)34-9-37-42(33,38-10-35-20(32)40-12(3)4)36-8-21(13(5)25-26-23)16(29)15(22)17(41-21)27-7-6-14(28)24-18(27)30/h6-7,11-12,15-17,29H,5,8-10H2,1-4H3,(H,24,28,30)/t15-,16+,17-,21+/m1/s1 |
| InChIKey | ABTGAVHARCGYFQ-WOYCLPQFSA-N |
| XLogP | 2.52 |
| TPSA | 248.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.46 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|