C15H21NO3 — CID 134547398
3-[(1E)-3-hydroxy-3-methylpenta-1,4-dienyl]-2,4,4-trimethyl-6-nitrosocyclohex-2-en-1-one (PubChem CID 134547398) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is 3-[(1E)-3-hydroxy-3-methylpenta-1,4-dienyl]-2,4,4-trimethyl-6-nitrosocyclohex-2-en-1-one.
| Compound Name | 3-[(1E)-3-hydroxy-3-methylpenta-1,4-dienyl]-2,4,4-trimethyl-6-nitrosocyclohex-2-en-1-one |
|---|---|
| PubChem CID | 134547398 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 3-[(1E)-3-hydroxy-3-methylpenta-1,4-dienyl]-2,4,4-trimethyl-6-nitrosocyclohex-2-en-1-one |
| SMILES | C=CC(C)(O)/C=C/C1=C(C)C(=O)C(N=O)CC1(C)C |
| InChI | InChI=1S/C15H21NO3/c1-6-15(5,18)8-7-11-10(2)13(17)12(16-19)9-14(11,3)4/h6-8,12,18H,1,9H2,2-5H3/b8-7+ |
| InChIKey | SIIPCEJDPDCGAJ-BQYQJAHWSA-N |
| XLogP | 2.93 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|