About 1-(5-methylcyclohepta-1,4,6-trien-1-yl)sulfanylpyrrolidine
1-(5-methylcyclohepta-1,4,6-trien-1-yl)sulfanylpyrrolidine (PubChem CID 134547847) has the molecular formula C12H17NS
and a molecular weight of 207.34 g/mol. Its IUPAC name is 1-(5-methylcyclohepta-1,4,6-trien-1-yl)sulfanylpyrrolidine.
Molecular Properties
| Compound Name | 1-(5-methylcyclohepta-1,4,6-trien-1-yl)sulfanylpyrrolidine |
| PubChem CID | 134547847 |
| Molecular Formula | C12H17NS |
| Molecular Weight | 207.34 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 1-(5-methylcyclohepta-1,4,6-trien-1-yl)sulfanylpyrrolidine |
| SMILES | CC1=CCC=C(SN2CCCC2)C=C1 |
| InChI | InChI=1S/C12H17NS/c1-11-5-4-6-12(8-7-11)14-13-9-2-3-10-13/h5-8H,2-4,9-10H2,1H3 |
| InChIKey | PFNRXHDIWPXNGH-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-methylcyclohepta-1,4,6-trien-1-yl)sulfanylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-methylcyclohepta-1,4,6-trien-1-yl)sulfanylpyrrolidine?
The IUPAC name of 1-(5-methylcyclohepta-1,4,6-trien-1-yl)sulfanylpyrrolidine (CID 134547847) is 1-(5-methylcyclohepta-1,4,6-trien-1-yl)sulfanylpyrrolidine.
What is the SMILES notation for 1-(5-methylcyclohepta-1,4,6-trien-1-yl)sulfanylpyrrolidine?
The canonical SMILES for 1-(5-methylcyclohepta-1,4,6-trien-1-yl)sulfanylpyrrolidine is CC1=CCC=C(SN2CCCC2)C=C1.
What is the InChIKey of 1-(5-methylcyclohepta-1,4,6-trien-1-yl)sulfanylpyrrolidine?
The InChIKey is PFNRXHDIWPXNGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NS/c1-11-5-4-6-12(8-7-11)14-13-9-2-3-10-13/h5-8H,2-4,9-10H2,1H3.
What are the key properties of 1-(5-methylcyclohepta-1,4,6-trien-1-yl)sulfanylpyrrolidine?
1-(5-methylcyclohepta-1,4,6-trien-1-yl)sulfanylpyrrolidine has a molecular weight of 207.34 g/mol, XLogP of 3.52, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-methylcyclohepta-1,4,6-trien-1-yl)sulfanylpyrrolidine is sourced from PubChem (CID 134547847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).