C16H23N7O2 — CID 134547975
1,3-diamino-1-methyl-3-[2-[(5-methyl-1,2,4-triazin-6-yl)oxymethyl]-3-propylphenyl]urea (PubChem CID 134547975) has the molecular formula C16H23N7O2 and a molecular weight of 345.41 g/mol. Its IUPAC name is 1,3-diamino-1-methyl-3-[2-[(5-methyl-1,2,4-triazin-6-yl)oxymethyl]-3-propylphenyl]urea.
| Compound Name | 1,3-diamino-1-methyl-3-[2-[(5-methyl-1,2,4-triazin-6-yl)oxymethyl]-3-propylphenyl]urea |
|---|---|
| PubChem CID | 134547975 |
| Molecular Formula | C16H23N7O2 |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 1,3-diamino-1-methyl-3-[2-[(5-methyl-1,2,4-triazin-6-yl)oxymethyl]-3-propylphenyl]urea |
| SMILES | CCCc1cccc(N(N)C(=O)N(C)N)c1COc1nncnc1C |
| InChI | InChI=1S/C16H23N7O2/c1-4-6-12-7-5-8-14(23(18)16(24)22(3)17)13(12)9-25-15-11(2)19-10-20-21-15/h5,7-8,10H,4,6,9,17-18H2,1-3H3 |
| InChIKey | CFSNZUKFXONNIF-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 123.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|