C18H24F3N3O — CID 134548030
[2-[amino(methyl)amino]-6-ethylphenyl]methyl N-[(1Z,3E)-5,5,5-trifluoro-4-methylpenta-1,3-dienyl]ethanimidate (PubChem CID 134548030) has the molecular formula C18H24F3N3O and a molecular weight of 355.40 g/mol. Its IUPAC name is [2-[amino(methyl)amino]-6-ethylphenyl]methyl N-[(1Z,3E)-5,5,5-trifluoro-4-methylpenta-1,3-dienyl]ethanimidate.
| Compound Name | [2-[amino(methyl)amino]-6-ethylphenyl]methyl N-[(1Z,3E)-5,5,5-trifluoro-4-methylpenta-1,3-dienyl]ethanimidate |
|---|---|
| PubChem CID | 134548030 |
| Molecular Formula | C18H24F3N3O |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | [2-[amino(methyl)amino]-6-ethylphenyl]methyl N-[(1Z,3E)-5,5,5-trifluoro-4-methylpenta-1,3-dienyl]ethanimidate |
| SMILES | CCc1cccc(N(C)N)c1CO/C(C)=N/C=C\C=C(/C)C(F)(F)F |
| InChI | InChI=1S/C18H24F3N3O/c1-5-15-9-6-10-17(24(4)22)16(15)12-25-14(3)23-11-7-8-13(2)18(19,20)21/h6-11H,5,12,22H2,1-4H3/b11-7-,13-8+,23-14+ |
| InChIKey | BZVPXTZSMOPOHO-VXDKQGNLSA-N |
| XLogP | 4.52 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|