C43H75N — CID 134548332
(12E,14E)-2-ethyl-4-methylidene-N-[(10E,12E,14E)-nonadeca-1,10,12,14-tetraen-2-yl]henicosa-12,14-dien-1-amine (PubChem CID 134548332) has the molecular formula C43H75N and a molecular weight of 606.08 g/mol. Its IUPAC name is (12E,14E)-2-ethyl-4-methylidene-N-[(10E,12E,14E)-nonadeca-1,10,12,14-tetraen-2-yl]henicosa-12,14-dien-1-amine.
| Compound Name | (12E,14E)-2-ethyl-4-methylidene-N-[(10E,12E,14E)-nonadeca-1,10,12,14-tetraen-2-yl]henicosa-12,14-dien-1-amine |
|---|---|
| PubChem CID | 134548332 |
| Molecular Formula | C43H75N |
| Molecular Weight | 606.08 g/mol |
| Exact Mass | 605.59 |
| IUPAC Name | (12E,14E)-2-ethyl-4-methylidene-N-[(10E,12E,14E)-nonadeca-1,10,12,14-tetraen-2-yl]henicosa-12,14-dien-1-amine |
| SMILES | C=C(CCCCCCC/C=C/C=C/CCCCCC)CC(CC)CNC(=C)CCCCCCC/C=C/C=C/C=C/CCCC |
| InChI | InChI=1S/C43H75N/c1-6-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-41(4)39-43(8-3)40-44-42(5)38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-7-2/h14,16-24,43-44H,4-13,15,25-40H2,1-3H3/b16-14+,19-17+,20-18+,23-21+,24-22+ |
| InChIKey | ADVPMSVZZKPRQO-UQZIIZEYSA-N |
| XLogP | 14.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.08 |
| LogP ≤ 5 | 14.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|