About N'-(2-ethylsulfanyl-5-fluorophenyl)-5-(trifluoromethyl)cyclohexa-1,3-diene-1-carbohydrazide
N'-(2-ethylsulfanyl-5-fluorophenyl)-5-(trifluoromethyl)cyclohexa-1,3-diene-1-carbohydrazide (PubChem CID 134548355) has the molecular formula C16H16F4N2OS
and a molecular weight of 360.38 g/mol. Its IUPAC name is N'-(2-ethylsulfanyl-5-fluorophenyl)-5-(trifluoromethyl)cyclohexa-1,3-diene-1-carbohydrazide.
Molecular Properties
| Compound Name | N'-(2-ethylsulfanyl-5-fluorophenyl)-5-(trifluoromethyl)cyclohexa-1,3-diene-1-carbohydrazide |
| PubChem CID | 134548355 |
| Molecular Formula | C16H16F4N2OS |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | N'-(2-ethylsulfanyl-5-fluorophenyl)-5-(trifluoromethyl)cyclohexa-1,3-diene-1-carbohydrazide |
| SMILES | CCSc1ccc(F)cc1NNC(=O)C1=CC=CC(C(F)(F)F)C1 |
| InChI | InChI=1S/C16H16F4N2OS/c1-2-24-14-7-6-12(17)9-13(14)21-22-15(23)10-4-3-5-11(8-10)16(18,19)20/h3-7,9,11,21H,2,8H2,1H3,(H,22,23) |
| InChIKey | PTDYQDKCTJVIFK-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-(2-ethylsulfanyl-5-fluorophenyl)-5-(trifluoromethyl)cyclohexa-1,3-diene-1-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-ethylsulfanyl-5-fluorophenyl)-5-(trifluoromethyl)cyclohexa-1,3-diene-1-carbohydrazide?
The IUPAC name of N'-(2-ethylsulfanyl-5-fluorophenyl)-5-(trifluoromethyl)cyclohexa-1,3-diene-1-carbohydrazide (CID 134548355) is N'-(2-ethylsulfanyl-5-fluorophenyl)-5-(trifluoromethyl)cyclohexa-1,3-diene-1-carbohydrazide.
What is the SMILES notation for N'-(2-ethylsulfanyl-5-fluorophenyl)-5-(trifluoromethyl)cyclohexa-1,3-diene-1-carbohydrazide?
The canonical SMILES for N'-(2-ethylsulfanyl-5-fluorophenyl)-5-(trifluoromethyl)cyclohexa-1,3-diene-1-carbohydrazide is CCSc1ccc(F)cc1NNC(=O)C1=CC=CC(C(F)(F)F)C1.
What is the InChIKey of N'-(2-ethylsulfanyl-5-fluorophenyl)-5-(trifluoromethyl)cyclohexa-1,3-diene-1-carbohydrazide?
The InChIKey is PTDYQDKCTJVIFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16F4N2OS/c1-2-24-14-7-6-12(17)9-13(14)21-22-15(23)10-4-3-5-11(8-10)16(18,19)20/h3-7,9,11,21H,2,8H2,1H3,(H,22,23).
What are the key properties of N'-(2-ethylsulfanyl-5-fluorophenyl)-5-(trifluoromethyl)cyclohexa-1,3-diene-1-carbohydrazide?
N'-(2-ethylsulfanyl-5-fluorophenyl)-5-(trifluoromethyl)cyclohexa-1,3-diene-1-carbohydrazide has a molecular weight of 360.38 g/mol, XLogP of 4.45, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-ethylsulfanyl-5-fluorophenyl)-5-(trifluoromethyl)cyclohexa-1,3-diene-1-carbohydrazide is sourced from PubChem (CID 134548355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).