C20H18N2O4 — CID 1345490
1-benzyl-5-(4-methoxy-3-methylbenzylidene)-2,4,6(1H,3H,5H)-pyrimidinetrione (PubChem CID 1345490) has the molecular formula C20H18N2O4 and a molecular weight of 350.40 g/mol. Its IUPAC name is (5E)-1-benzyl-5-[(4-methoxy-3-methylphenyl)methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-benzyl-5-(4-methoxy-3-methylbenzylidene)-2,4,6(1H,3H,5H)-pyrimidinetrione |
|---|---|
| PubChem CID | 1345490 |
| Molecular Formula | C20H18N2O4 |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | (5E)-1-benzyl-5-[(4-methoxy-3-methylphenyl)methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | CC1=C(C=CC(=C1)/C=C/2\C(=O)NC(=O)N(C2=O)CC3=CC=CC=C3)OC |
| InChI | InChI=1S/C20H18N2O4/c1-13-10-15(8-9-17(13)26-2)11-16-18(23)21-20(25)22(19(16)24)12-14-6-4-3-5-7-14/h3-11H,12H2,1-2H3,(H,21,23,25)/b16-11+ |
| InChIKey | QHCIPTKLFXHWFQ-LFIBNONCSA-N |
| XLogP | 3.00 |
| TPSA | 75.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | 595 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|