C28H32N4O3S — CID 134549217
5-(4-amino-2-ethylphenyl)-N-[(4-sulfamoylphenyl)methyl]spiro[2H-indole-3,1'-cyclopentane]-1-carboxamide (PubChem CID 134549217) has the molecular formula C28H32N4O3S and a molecular weight of 504.66 g/mol. Its IUPAC name is 5-(4-amino-2-ethylphenyl)-N-[(4-sulfamoylphenyl)methyl]spiro[2H-indole-3,1'-cyclopentane]-1-carboxamide.
| Compound Name | 5-(4-amino-2-ethylphenyl)-N-[(4-sulfamoylphenyl)methyl]spiro[2H-indole-3,1'-cyclopentane]-1-carboxamide |
|---|---|
| PubChem CID | 134549217 |
| Molecular Formula | C28H32N4O3S |
| Molecular Weight | 504.66 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | 5-(4-amino-2-ethylphenyl)-N-[(4-sulfamoylphenyl)methyl]spiro[2H-indole-3,1'-cyclopentane]-1-carboxamide |
| SMILES | CCc1cc(N)ccc1-c1ccc2c(c1)C1(CCCC1)CN2C(=O)NCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C28H32N4O3S/c1-2-20-15-22(29)8-11-24(20)21-7-12-26-25(16-21)28(13-3-4-14-28)18-32(26)27(33)31-17-19-5-9-23(10-6-19)36(30,34)35/h5-12,15-16H,2-4,13-14,17-18,29H2,1H3,(H,31,33)(H2,30,34,35) |
| InChIKey | OCPJBHVPFMRLOI-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 118.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.66 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|