About 1-(4-chlorocyclohexa-2,4-dien-1-yl)ethenamine
1-(4-chlorocyclohexa-2,4-dien-1-yl)ethenamine (PubChem CID 134549387) has the molecular formula C8H10ClN
and a molecular weight of 155.63 g/mol. Its IUPAC name is 1-(4-chlorocyclohexa-2,4-dien-1-yl)ethenamine.
Molecular Properties
| Compound Name | 1-(4-chlorocyclohexa-2,4-dien-1-yl)ethenamine |
| PubChem CID | 134549387 |
| Molecular Formula | C8H10ClN |
| Molecular Weight | 155.63 g/mol |
| Exact Mass | 155.05 |
| IUPAC Name | 1-(4-chlorocyclohexa-2,4-dien-1-yl)ethenamine |
| SMILES | C=C(N)C1C=CC(Cl)=CC1 |
| InChI | InChI=1S/C8H10ClN/c1-6(10)7-2-4-8(9)5-3-7/h2,4-5,7H,1,3,10H2 |
| InChIKey | WPTNQLJTDSXRDQ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.63 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(4-chlorocyclohexa-2,4-dien-1-yl)ethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chlorocyclohexa-2,4-dien-1-yl)ethenamine?
The IUPAC name of 1-(4-chlorocyclohexa-2,4-dien-1-yl)ethenamine (CID 134549387) is 1-(4-chlorocyclohexa-2,4-dien-1-yl)ethenamine.
What is the SMILES notation for 1-(4-chlorocyclohexa-2,4-dien-1-yl)ethenamine?
The canonical SMILES for 1-(4-chlorocyclohexa-2,4-dien-1-yl)ethenamine is C=C(N)C1C=CC(Cl)=CC1.
What is the InChIKey of 1-(4-chlorocyclohexa-2,4-dien-1-yl)ethenamine?
The InChIKey is WPTNQLJTDSXRDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10ClN/c1-6(10)7-2-4-8(9)5-3-7/h2,4-5,7H,1,3,10H2.
What are the key properties of 1-(4-chlorocyclohexa-2,4-dien-1-yl)ethenamine?
1-(4-chlorocyclohexa-2,4-dien-1-yl)ethenamine has a molecular weight of 155.63 g/mol, XLogP of 2.16, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chlorocyclohexa-2,4-dien-1-yl)ethenamine is sourced from PubChem (CID 134549387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).