C16H25N — CID 134549524
(3Z,6E)-4-ethyl-8-[2-(2-methylcyclobutyl)ethyl]-2,5-dihydroazocine (PubChem CID 134549524) has the molecular formula C16H25N and a molecular weight of 231.38 g/mol. Its IUPAC name is (3Z,6E)-4-ethyl-8-[2-(2-methylcyclobutyl)ethyl]-2,5-dihydroazocine.
| Compound Name | (3Z,6E)-4-ethyl-8-[2-(2-methylcyclobutyl)ethyl]-2,5-dihydroazocine |
|---|---|
| PubChem CID | 134549524 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | (3Z,6E)-4-ethyl-8-[2-(2-methylcyclobutyl)ethyl]-2,5-dihydroazocine |
| SMILES | CC/C1=C/C/N=C(CCC2CCC2C)\C=C/C1 |
| InChI | InChI=1S/C16H25N/c1-3-14-5-4-6-16(17-12-11-14)10-9-15-8-7-13(15)2/h4,6,11,13,15H,3,5,7-10,12H2,1-2H3/b6-4-,14-11-,17-16+ |
| InChIKey | BUNIZXZGYOZPDJ-IIBLRJTKSA-N |
| XLogP | 4.55 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|