C20H22F3N3O3 — CID 134549751
6-[amino-[methyl-(2,2,2-trifluoro-1-hydroxyethyl)amino]methyl]-2-[(3-methoxyphenyl)methyl]-3H-isoindol-1-one (PubChem CID 134549751) has the molecular formula C20H22F3N3O3 and a molecular weight of 409.41 g/mol. Its IUPAC name is 6-[amino-[methyl-(2,2,2-trifluoro-1-hydroxyethyl)amino]methyl]-2-[(3-methoxyphenyl)methyl]-3H-isoindol-1-one.
| Compound Name | 6-[amino-[methyl-(2,2,2-trifluoro-1-hydroxyethyl)amino]methyl]-2-[(3-methoxyphenyl)methyl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 134549751 |
| Molecular Formula | C20H22F3N3O3 |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 6-[amino-[methyl-(2,2,2-trifluoro-1-hydroxyethyl)amino]methyl]-2-[(3-methoxyphenyl)methyl]-3H-isoindol-1-one |
| SMILES | COc1cccc(CN2Cc3ccc(C(N)N(C)C(O)C(F)(F)F)cc3C2=O)c1 |
| InChI | InChI=1S/C20H22F3N3O3/c1-25(19(28)20(21,22)23)17(24)13-6-7-14-11-26(18(27)16(14)9-13)10-12-4-3-5-15(8-12)29-2/h3-9,17,19,28H,10-11,24H2,1-2H3 |
| InChIKey | JHYYMTPZEANKOH-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|