About (Z)-N-ethenyl-6,6-dimethylhept-2-en-4-imine
(Z)-N-ethenyl-6,6-dimethylhept-2-en-4-imine (PubChem CID 134549794) has the molecular formula C11H19N
and a molecular weight of 165.28 g/mol. Its IUPAC name is (Z)-N-ethenyl-6,6-dimethylhept-2-en-4-imine.
Molecular Properties
| Compound Name | (Z)-N-ethenyl-6,6-dimethylhept-2-en-4-imine |
| PubChem CID | 134549794 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | (Z)-N-ethenyl-6,6-dimethylhept-2-en-4-imine |
| SMILES | C=C/N=C(\C=C/C)CC(C)(C)C |
| InChI | InChI=1S/C11H19N/c1-6-8-10(12-7-2)9-11(3,4)5/h6-8H,2,9H2,1,3-5H3/b8-6-,12-10+ |
| InChIKey | GTWWALXCSJQZNQ-DEOFSOSHSA-N |
| XLogP | 3.58 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N-ethenyl-6,6-dimethylhept-2-en-4-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-ethenyl-6,6-dimethylhept-2-en-4-imine?
The IUPAC name of (Z)-N-ethenyl-6,6-dimethylhept-2-en-4-imine (CID 134549794) is (Z)-N-ethenyl-6,6-dimethylhept-2-en-4-imine.
What is the SMILES notation for (Z)-N-ethenyl-6,6-dimethylhept-2-en-4-imine?
The canonical SMILES for (Z)-N-ethenyl-6,6-dimethylhept-2-en-4-imine is C=C/N=C(\C=C/C)CC(C)(C)C.
What is the InChIKey of (Z)-N-ethenyl-6,6-dimethylhept-2-en-4-imine?
The InChIKey is GTWWALXCSJQZNQ-DEOFSOSHSA-N. The full InChI is InChI=1S/C11H19N/c1-6-8-10(12-7-2)9-11(3,4)5/h6-8H,2,9H2,1,3-5H3/b8-6-,12-10+.
What are the key properties of (Z)-N-ethenyl-6,6-dimethylhept-2-en-4-imine?
(Z)-N-ethenyl-6,6-dimethylhept-2-en-4-imine has a molecular weight of 165.28 g/mol, XLogP of 3.58, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-ethenyl-6,6-dimethylhept-2-en-4-imine is sourced from PubChem (CID 134549794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).