About [(Z,2S)-5-[[(2R)-2-methoxypentan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate
[(Z,2S)-5-[[(2R)-2-methoxypentan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate (PubChem CID 134550169) has the molecular formula C13H23NO4
and a molecular weight of 257.33 g/mol. Its IUPAC name is [(Z,2S)-5-[[(2R)-2-methoxypentan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate.
Molecular Properties
| Compound Name | [(Z,2S)-5-[[(2R)-2-methoxypentan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate |
| PubChem CID | 134550169 |
| Molecular Formula | C13H23NO4 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | [(Z,2S)-5-[[(2R)-2-methoxypentan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate |
| SMILES | CCC(NC(=O)/C=C\[C@H](C)OC(C)=O)[C@@H](C)OC |
| InChI | InChI=1S/C13H23NO4/c1-6-12(10(3)17-5)14-13(16)8-7-9(2)18-11(4)15/h7-10,12H,6H2,1-5H3,(H,14,16)/b8-7-/t9-,10+,12?/m0/s1 |
| InChIKey | KOORTFMNTFLJND-JCNDPGIGSA-N |
| XLogP | 1.42 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [(Z,2S)-5-[[(2R)-2-methoxypentan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z,2S)-5-[[(2R)-2-methoxypentan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate?
The IUPAC name of [(Z,2S)-5-[[(2R)-2-methoxypentan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate (CID 134550169) is [(Z,2S)-5-[[(2R)-2-methoxypentan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate.
What is the SMILES notation for [(Z,2S)-5-[[(2R)-2-methoxypentan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate?
The canonical SMILES for [(Z,2S)-5-[[(2R)-2-methoxypentan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate is CCC(NC(=O)/C=C\[C@H](C)OC(C)=O)[C@@H](C)OC.
What is the InChIKey of [(Z,2S)-5-[[(2R)-2-methoxypentan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate?
The InChIKey is KOORTFMNTFLJND-JCNDPGIGSA-N. The full InChI is InChI=1S/C13H23NO4/c1-6-12(10(3)17-5)14-13(16)8-7-9(2)18-11(4)15/h7-10,12H,6H2,1-5H3,(H,14,16)/b8-7-/t9-,10+,12?/m0/s1.
What are the key properties of [(Z,2S)-5-[[(2R)-2-methoxypentan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate?
[(Z,2S)-5-[[(2R)-2-methoxypentan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate has a molecular weight of 257.33 g/mol, XLogP of 1.42, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z,2S)-5-[[(2R)-2-methoxypentan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate is sourced from PubChem (CID 134550169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).