About N-[(2R,5S)-6-butyl-2,5-dimethyloxan-3-yl]formamide
N-[(2R,5S)-6-butyl-2,5-dimethyloxan-3-yl]formamide (PubChem CID 134550179) has the molecular formula C12H23NO2
and a molecular weight of 213.32 g/mol. Its IUPAC name is N-[(2R,5S)-6-butyl-2,5-dimethyloxan-3-yl]formamide.
Molecular Properties
| Compound Name | N-[(2R,5S)-6-butyl-2,5-dimethyloxan-3-yl]formamide |
| PubChem CID | 134550179 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | N-[(2R,5S)-6-butyl-2,5-dimethyloxan-3-yl]formamide |
| SMILES | CCCCC1O[C@H](C)C(NC=O)C[C@@H]1C |
| InChI | InChI=1S/C12H23NO2/c1-4-5-6-12-9(2)7-11(13-8-14)10(3)15-12/h8-12H,4-7H2,1-3H3,(H,13,14)/t9-,10+,11?,12?/m0/s1 |
| InChIKey | RPTKWBLBCOHNQW-DMOGRIERSA-N |
| XLogP | 2.10 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[(2R,5S)-6-butyl-2,5-dimethyloxan-3-yl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2R,5S)-6-butyl-2,5-dimethyloxan-3-yl]formamide?
The IUPAC name of N-[(2R,5S)-6-butyl-2,5-dimethyloxan-3-yl]formamide (CID 134550179) is N-[(2R,5S)-6-butyl-2,5-dimethyloxan-3-yl]formamide.
What is the SMILES notation for N-[(2R,5S)-6-butyl-2,5-dimethyloxan-3-yl]formamide?
The canonical SMILES for N-[(2R,5S)-6-butyl-2,5-dimethyloxan-3-yl]formamide is CCCCC1O[C@H](C)C(NC=O)C[C@@H]1C.
What is the InChIKey of N-[(2R,5S)-6-butyl-2,5-dimethyloxan-3-yl]formamide?
The InChIKey is RPTKWBLBCOHNQW-DMOGRIERSA-N. The full InChI is InChI=1S/C12H23NO2/c1-4-5-6-12-9(2)7-11(13-8-14)10(3)15-12/h8-12H,4-7H2,1-3H3,(H,13,14)/t9-,10+,11?,12?/m0/s1.
What are the key properties of N-[(2R,5S)-6-butyl-2,5-dimethyloxan-3-yl]formamide?
N-[(2R,5S)-6-butyl-2,5-dimethyloxan-3-yl]formamide has a molecular weight of 213.32 g/mol, XLogP of 2.10, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2R,5S)-6-butyl-2,5-dimethyloxan-3-yl]formamide is sourced from PubChem (CID 134550179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).