C20H36O3 — CID 134550340
(2S,3S,6R)-2-[(2E,4E,6S)-8-methoxy-3-methyl-6-propoxyocta-2,4-dienyl]-3,6-dimethyloxane (PubChem CID 134550340) has the molecular formula C20H36O3 and a molecular weight of 324.51 g/mol. Its IUPAC name is (2S,3S,6R)-2-[(2E,4E,6S)-8-methoxy-3-methyl-6-propoxyocta-2,4-dienyl]-3,6-dimethyloxane.
| Compound Name | (2S,3S,6R)-2-[(2E,4E,6S)-8-methoxy-3-methyl-6-propoxyocta-2,4-dienyl]-3,6-dimethyloxane |
|---|---|
| PubChem CID | 134550340 |
| Molecular Formula | C20H36O3 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.27 |
| IUPAC Name | (2S,3S,6R)-2-[(2E,4E,6S)-8-methoxy-3-methyl-6-propoxyocta-2,4-dienyl]-3,6-dimethyloxane |
| SMILES | CCCO[C@H](/C=C/C(C)=C/C[C@@H]1O[C@H](C)CC[C@@H]1C)CCOC |
| InChI | InChI=1S/C20H36O3/c1-6-14-22-19(13-15-21-5)11-7-16(2)8-12-20-17(3)9-10-18(4)23-20/h7-8,11,17-20H,6,9-10,12-15H2,1-5H3/b11-7+,16-8+/t17-,18+,19+,20-/m0/s1 |
| InChIKey | GKSNJMHAXJXERP-ATECNGCESA-N |
| XLogP | 4.91 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|